C19H22N3O2S+ — CID 9055226
[2-(4-cyanoanilino)-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 9055226) has the molecular formula C19H22N3O2S+ and a molecular weight of 356.47 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 9055226 |
| Molecular Formula | C19H22N3O2S+ |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | N#Cc1ccc(NC(=O)C[NH+](Cc2cccs2)C[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C19H21N3O2S/c20-11-15-5-7-16(8-6-15)21-19(23)14-22(12-17-3-1-9-24-17)13-18-4-2-10-25-18/h2,4-8,10,17H,1,3,9,12-14H2,(H,21,23)/p+1/t17-/m1/s1 |
| InChIKey | XZRKASIIVWAJCV-QGZVFWFLSA-O |
| XLogP | 1.82 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |