C25H29N2O2S+ — CID 9055360
[2-(2-benzylanilino)-2-oxoethyl]-[[(2S)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 9055360) has the molecular formula C25H29N2O2S+ and a molecular weight of 421.59 g/mol. Its IUPAC name is [2-(2-benzylanilino)-2-oxoethyl]-[[(2S)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-(2-benzylanilino)-2-oxoethyl]-[[(2S)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 9055360 |
| Molecular Formula | C25H29N2O2S+ |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [2-(2-benzylanilino)-2-oxoethyl]-[[(2S)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | O=C(C[NH+](Cc1cccs1)C[C@@H]1CCCO1)Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C25H28N2O2S/c28-25(19-27(17-22-11-6-14-29-22)18-23-12-7-15-30-23)26-24-13-5-4-10-21(24)16-20-8-2-1-3-9-20/h1-5,7-10,12-13,15,22H,6,11,14,16-19H2,(H,26,28)/p+1/t22-/m0/s1 |
| InChIKey | RNDLVQLYYGKSPB-QFIPXVFZSA-O |
| XLogP | 3.54 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |