C17H14F2N2O3S — CID 90553735
2-[3-[(3,5-difluorophenyl)sulfonylamino]prop-1-ynyl]-N-methylbenzamide (PubChem CID 90553735) has the molecular formula C17H14F2N2O3S and a molecular weight of 364.37 g/mol. Its IUPAC name is 2-[3-[(3,5-difluorophenyl)sulfonylamino]prop-1-ynyl]-N-methylbenzamide.
| Compound Name | 2-[3-[(3,5-difluorophenyl)sulfonylamino]prop-1-ynyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 90553735 |
| Molecular Formula | C17H14F2N2O3S |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-[3-[(3,5-difluorophenyl)sulfonylamino]prop-1-ynyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1C#CCNS(=O)(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H14F2N2O3S/c1-20-17(22)16-7-3-2-5-12(16)6-4-8-21-25(23,24)15-10-13(18)9-14(19)11-15/h2-3,5,7,9-11,21H,8H2,1H3,(H,20,22) |
| InChIKey | ZEDWTKVPFSVGNG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|