C11H19F3N2O3 — CID 90554860
3-(2-methoxyethyl)-1-(oxan-4-yl)-1-(2,2,2-trifluoroethyl)urea (PubChem CID 90554860) has the molecular formula C11H19F3N2O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-1-(oxan-4-yl)-1-(2,2,2-trifluoroethyl)urea.
| Compound Name | 3-(2-methoxyethyl)-1-(oxan-4-yl)-1-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 90554860 |
| Molecular Formula | C11H19F3N2O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-(2-methoxyethyl)-1-(oxan-4-yl)-1-(2,2,2-trifluoroethyl)urea |
| SMILES | COCCNC(=O)N(CC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C11H19F3N2O3/c1-18-7-4-15-10(17)16(8-11(12,13)14)9-2-5-19-6-3-9/h9H,2-8H2,1H3,(H,15,17) |
| InChIKey | WBSOGGWIGACBSP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|