C10H18F3NO3S — CID 90554914
N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)propane-2-sulfonamide (PubChem CID 90554914) has the molecular formula C10H18F3NO3S and a molecular weight of 289.32 g/mol. Its IUPAC name is N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)propane-2-sulfonamide.
| Compound Name | N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 90554914 |
| Molecular Formula | C10H18F3NO3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)N(CC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C10H18F3NO3S/c1-8(2)18(15,16)14(7-10(11,12)13)9-3-5-17-6-4-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | ZIODJVSFQCBKKT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |