C23H26N4O3 — CID 90555336
N-[(1-cyclopentyl-5-pyridin-4-ylpyrazol-3-yl)methyl]-2-(2-methoxyphenoxy)acetamide (PubChem CID 90555336) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-[(1-cyclopentyl-5-pyridin-4-ylpyrazol-3-yl)methyl]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-[(1-cyclopentyl-5-pyridin-4-ylpyrazol-3-yl)methyl]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 90555336 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-[(1-cyclopentyl-5-pyridin-4-ylpyrazol-3-yl)methyl]-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)NCc1cc(-c2ccncc2)n(C2CCCC2)n1 |
| InChI | InChI=1S/C23H26N4O3/c1-29-21-8-4-5-9-22(21)30-16-23(28)25-15-18-14-20(17-10-12-24-13-11-17)27(26-18)19-6-2-3-7-19/h4-5,8-14,19H,2-3,6-7,15-16H2,1H3,(H,25,28) |
| InChIKey | BBSGLICUKIXNLS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |