C22H23FN4OS — CID 90555343
N-[(1-cyclopentyl-5-pyridin-4-ylpyrazol-3-yl)methyl]-2-(4-fluorophenyl)sulfanylacetamide (PubChem CID 90555343) has the molecular formula C22H23FN4OS and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[(1-cyclopentyl-5-pyridin-4-ylpyrazol-3-yl)methyl]-2-(4-fluorophenyl)sulfanylacetamide.
| Compound Name | N-[(1-cyclopentyl-5-pyridin-4-ylpyrazol-3-yl)methyl]-2-(4-fluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 90555343 |
| Molecular Formula | C22H23FN4OS |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-[(1-cyclopentyl-5-pyridin-4-ylpyrazol-3-yl)methyl]-2-(4-fluorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(F)cc1)NCc1cc(-c2ccncc2)n(C2CCCC2)n1 |
| InChI | InChI=1S/C22H23FN4OS/c23-17-5-7-20(8-6-17)29-15-22(28)25-14-18-13-21(16-9-11-24-12-10-16)27(26-18)19-3-1-2-4-19/h5-13,19H,1-4,14-15H2,(H,25,28) |
| InChIKey | BHVPDEABIBWWPD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |