C22H24N4O — CID 90557029
1-[3-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)phenyl]-3-(3-phenylpropyl)urea (PubChem CID 90557029) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-[3-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)phenyl]-3-(3-phenylpropyl)urea.
| Compound Name | 1-[3-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)phenyl]-3-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 90557029 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[3-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)phenyl]-3-(3-phenylpropyl)urea |
| SMILES | O=C(NCCCc1ccccc1)Nc1cccc(-c2cnc3n2CCC3)c1 |
| InChI | InChI=1S/C22H24N4O/c27-22(23-13-5-9-17-7-2-1-3-8-17)25-19-11-4-10-18(15-19)20-16-24-21-12-6-14-26(20)21/h1-4,7-8,10-11,15-16H,5-6,9,12-14H2,(H2,23,25,27) |
| InChIKey | MVDUMGYLMVXWTI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|