C23H26N4O2 — CID 90557031
1-(4-butoxyphenyl)-3-[3-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)phenyl]urea (PubChem CID 90557031) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-[3-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)phenyl]urea.
| Compound Name | 1-(4-butoxyphenyl)-3-[3-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 90557031 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-[3-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)phenyl]urea |
| SMILES | CCCCOc1ccc(NC(=O)Nc2cccc(-c3cnc4n3CCC4)c2)cc1 |
| InChI | InChI=1S/C23H26N4O2/c1-2-3-14-29-20-11-9-18(10-12-20)25-23(28)26-19-7-4-6-17(15-19)21-16-24-22-8-5-13-27(21)22/h4,6-7,9-12,15-16H,2-3,5,8,13-14H2,1H3,(H2,25,26,28) |
| InChIKey | CGFAKMFMXJMKFB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|