About 1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide
1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide (PubChem CID 90557797) has the molecular formula C22H21N7O2
and a molecular weight of 415.46 g/mol. Its IUPAC name is 1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide |
| PubChem CID | 90557797 |
| Molecular Formula | C22H21N7O2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide |
| SMILES | CCn1nnc2c(N3CC(C(=O)Nc4ccccc4Oc4ccccc4)C3)ncnc21 |
| InChI | InChI=1S/C22H21N7O2/c1-2-29-21-19(26-27-29)20(23-14-24-21)28-12-15(13-28)22(30)25-17-10-6-7-11-18(17)31-16-8-4-3-5-9-16/h3-11,14-15H,2,12-13H2,1H3,(H,25,30) |
| InChIKey | DRVOGUPZMBSOTJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide?
The IUPAC name of 1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide (CID 90557797) is 1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide.
What is the SMILES notation for 1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide?
The canonical SMILES for 1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide is CCn1nnc2c(N3CC(C(=O)Nc4ccccc4Oc4ccccc4)C3)ncnc21.
What is the InChIKey of 1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide?
The InChIKey is DRVOGUPZMBSOTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N7O2/c1-2-29-21-19(26-27-29)20(23-14-24-21)28-12-15(13-28)22(30)25-17-10-6-7-11-18(17)31-16-8-4-3-5-9-16/h3-11,14-15H,2,12-13H2,1H3,(H,25,30).
What are the key properties of 1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide?
1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide has a molecular weight of 415.46 g/mol, XLogP of 3.11, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide is sourced from PubChem (CID 90557797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).