C18H21N3O2S — CID 90558763
(2-ethylsulfanylphenyl)-(4-pyrimidin-2-yloxypiperidin-1-yl)methanone (PubChem CID 90558763) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is (2-ethylsulfanylphenyl)-(4-pyrimidin-2-yloxypiperidin-1-yl)methanone.
| Compound Name | (2-ethylsulfanylphenyl)-(4-pyrimidin-2-yloxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 90558763 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (2-ethylsulfanylphenyl)-(4-pyrimidin-2-yloxypiperidin-1-yl)methanone |
| SMILES | CCSc1ccccc1C(=O)N1CCC(Oc2ncccn2)CC1 |
| InChI | InChI=1S/C18H21N3O2S/c1-2-24-16-7-4-3-6-15(16)17(22)21-12-8-14(9-13-21)23-18-19-10-5-11-20-18/h3-7,10-11,14H,2,8-9,12-13H2,1H3 |
| InChIKey | OOHAFJQJTAMGMD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |