C18H20ClN3O2S — CID 122259400
[3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]-(2-ethylsulfanylphenyl)methanone (PubChem CID 122259400) has the molecular formula C18H20ClN3O2S and a molecular weight of 377.90 g/mol. Its IUPAC name is [3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]-(2-ethylsulfanylphenyl)methanone.
| Compound Name | [3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]-(2-ethylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 122259400 |
| Molecular Formula | C18H20ClN3O2S |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]-(2-ethylsulfanylphenyl)methanone |
| SMILES | CCSc1ccccc1C(=O)N1CCCC(Oc2ncc(Cl)cn2)C1 |
| InChI | InChI=1S/C18H20ClN3O2S/c1-2-25-16-8-4-3-7-15(16)17(23)22-9-5-6-14(12-22)24-18-20-10-13(19)11-21-18/h3-4,7-8,10-11,14H,2,5-6,9,12H2,1H3 |
| InChIKey | SYTGRQUFGFVTTL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |