C16H15ClN4O4 — CID 122259334
[3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]-(2-nitrophenyl)methanone (PubChem CID 122259334) has the molecular formula C16H15ClN4O4 and a molecular weight of 362.77 g/mol. Its IUPAC name is [3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]-(2-nitrophenyl)methanone.
| Compound Name | [3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]-(2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 122259334 |
| Molecular Formula | C16H15ClN4O4 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | [3-(5-chloropyrimidin-2-yl)oxypiperidin-1-yl]-(2-nitrophenyl)methanone |
| SMILES | O=C(c1ccccc1[N+](=O)[O-])N1CCCC(Oc2ncc(Cl)cn2)C1 |
| InChI | InChI=1S/C16H15ClN4O4/c17-11-8-18-16(19-9-11)25-12-4-3-7-20(10-12)15(22)13-5-1-2-6-14(13)21(23)24/h1-2,5-6,8-9,12H,3-4,7,10H2 |
| InChIKey | GZYYBBXBRXOBFZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|