C15H13Cl2N3O2 — CID 119100517
(2-chlorophenyl)-[3-(5-chloropyrimidin-2-yl)oxypyrrolidin-1-yl]methanone (PubChem CID 119100517) has the molecular formula C15H13Cl2N3O2 and a molecular weight of 338.19 g/mol. Its IUPAC name is (2-chlorophenyl)-[3-(5-chloropyrimidin-2-yl)oxypyrrolidin-1-yl]methanone.
| Compound Name | (2-chlorophenyl)-[3-(5-chloropyrimidin-2-yl)oxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 119100517 |
| Molecular Formula | C15H13Cl2N3O2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | (2-chlorophenyl)-[3-(5-chloropyrimidin-2-yl)oxypyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1Cl)N1CCC(Oc2ncc(Cl)cn2)C1 |
| InChI | InChI=1S/C15H13Cl2N3O2/c16-10-7-18-15(19-8-10)22-11-5-6-20(9-11)14(21)12-3-1-2-4-13(12)17/h1-4,7-8,11H,5-6,9H2 |
| InChIKey | UCIDVCDCKZSJKS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |