C16H16ClN3O3 — CID 90639091
(2-chlorophenyl)-[3-(6-methoxypyridazin-3-yl)oxypyrrolidin-1-yl]methanone (PubChem CID 90639091) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is (2-chlorophenyl)-[3-(6-methoxypyridazin-3-yl)oxypyrrolidin-1-yl]methanone.
| Compound Name | (2-chlorophenyl)-[3-(6-methoxypyridazin-3-yl)oxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 90639091 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (2-chlorophenyl)-[3-(6-methoxypyridazin-3-yl)oxypyrrolidin-1-yl]methanone |
| SMILES | COc1ccc(OC2CCN(C(=O)c3ccccc3Cl)C2)nn1 |
| InChI | InChI=1S/C16H16ClN3O3/c1-22-14-6-7-15(19-18-14)23-11-8-9-20(10-11)16(21)12-4-2-3-5-13(12)17/h2-7,11H,8-10H2,1H3 |
| InChIKey | XMPYCBCZSWFBAG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |