C17H19BrN4O2 — CID 90639547
(2-bromophenyl)-[3-[6-(dimethylamino)pyridazin-3-yl]oxypyrrolidin-1-yl]methanone (PubChem CID 90639547) has the molecular formula C17H19BrN4O2 and a molecular weight of 391.27 g/mol. Its IUPAC name is (2-bromophenyl)-[3-[6-(dimethylamino)pyridazin-3-yl]oxypyrrolidin-1-yl]methanone.
| Compound Name | (2-bromophenyl)-[3-[6-(dimethylamino)pyridazin-3-yl]oxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 90639547 |
| Molecular Formula | C17H19BrN4O2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (2-bromophenyl)-[3-[6-(dimethylamino)pyridazin-3-yl]oxypyrrolidin-1-yl]methanone |
| SMILES | CN(C)c1ccc(OC2CCN(C(=O)c3ccccc3Br)C2)nn1 |
| InChI | InChI=1S/C17H19BrN4O2/c1-21(2)15-7-8-16(20-19-15)24-12-9-10-22(11-12)17(23)13-5-3-4-6-14(13)18/h3-8,12H,9-11H2,1-2H3 |
| InChIKey | IIIPQVFCWBNLNR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |