C15H12ClF2N3O2 — CID 129355694
(2-chloro-6-fluorophenyl)-[(3S)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]methanone (PubChem CID 129355694) has the molecular formula C15H12ClF2N3O2 and a molecular weight of 339.73 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-[(3S)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]methanone.
| Compound Name | (2-chloro-6-fluorophenyl)-[(3S)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 129355694 |
| Molecular Formula | C15H12ClF2N3O2 |
| Molecular Weight | 339.73 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-[(3S)-3-(5-fluoropyrimidin-2-yl)oxypyrrolidin-1-yl]methanone |
| SMILES | O=C(c1c(F)cccc1Cl)N1CC[C@H](Oc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C15H12ClF2N3O2/c16-11-2-1-3-12(18)13(11)14(22)21-5-4-10(8-21)23-15-19-6-9(17)7-20-15/h1-3,6-7,10H,4-5,8H2/t10-/m0/s1 |
| InChIKey | OKBXPQHIFXFTRB-JTQLQIEISA-N |
| XLogP | 2.70 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.73 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |