C15H13ClFN3O2 — CID 100753127
(2-chloro-6-fluorophenyl)-[(3R)-3-pyrazin-2-yloxypyrrolidin-1-yl]methanone (PubChem CID 100753127) has the molecular formula C15H13ClFN3O2 and a molecular weight of 321.74 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-[(3R)-3-pyrazin-2-yloxypyrrolidin-1-yl]methanone.
| Compound Name | (2-chloro-6-fluorophenyl)-[(3R)-3-pyrazin-2-yloxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 100753127 |
| Molecular Formula | C15H13ClFN3O2 |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-[(3R)-3-pyrazin-2-yloxypyrrolidin-1-yl]methanone |
| SMILES | O=C(c1c(F)cccc1Cl)N1CC[C@@H](Oc2cnccn2)C1 |
| InChI | InChI=1S/C15H13ClFN3O2/c16-11-2-1-3-12(17)14(11)15(21)20-7-4-10(9-20)22-13-8-18-5-6-19-13/h1-3,5-6,8,10H,4,7,9H2/t10-/m1/s1 |
| InChIKey | CLGLCNSCSQEQDJ-SNVBAGLBSA-N |
| XLogP | 2.56 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |