C15H15N3O4 — CID 90559065
5-(4-pyrazin-2-yloxypiperidine-1-carbonyl)pyran-2-one (PubChem CID 90559065) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is 5-(4-pyrazin-2-yloxypiperidine-1-carbonyl)pyran-2-one.
| Compound Name | 5-(4-pyrazin-2-yloxypiperidine-1-carbonyl)pyran-2-one |
|---|---|
| PubChem CID | 90559065 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 5-(4-pyrazin-2-yloxypiperidine-1-carbonyl)pyran-2-one |
| SMILES | O=C(c1ccc(=O)oc1)N1CCC(Oc2cnccn2)CC1 |
| InChI | InChI=1S/C15H15N3O4/c19-14-2-1-11(10-21-14)15(20)18-7-3-12(4-8-18)22-13-9-16-5-6-17-13/h1-2,5-6,9-10,12H,3-4,7-8H2 |
| InChIKey | KFZJMGSDYGLEAJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |