C13H14N4O2S — CID 95811378
(4-pyrazin-2-yloxypiperidin-1-yl)-(1,3-thiazol-5-yl)methanone (PubChem CID 95811378) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is (4-pyrazin-2-yloxypiperidin-1-yl)-(1,3-thiazol-5-yl)methanone.
| Compound Name | (4-pyrazin-2-yloxypiperidin-1-yl)-(1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 95811378 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (4-pyrazin-2-yloxypiperidin-1-yl)-(1,3-thiazol-5-yl)methanone |
| SMILES | O=C(c1cncs1)N1CCC(Oc2cnccn2)CC1 |
| InChI | InChI=1S/C13H14N4O2S/c18-13(11-7-15-9-20-11)17-5-1-10(2-6-17)19-12-8-14-3-4-16-12/h3-4,7-10H,1-2,5-6H2 |
| InChIKey | SGWYJRKWUVTELL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |