C16H27ClN4O — CID 90561530
3-chloro-1-[4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 90561530) has the molecular formula C16H27ClN4O and a molecular weight of 326.87 g/mol. Its IUPAC name is 3-chloro-1-[4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-[4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 90561530 |
| Molecular Formula | C16H27ClN4O |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 3-chloro-1-[4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CCc1nccn1CCN1CCN(C(=O)C(C)(C)CCl)CC1 |
| InChI | InChI=1S/C16H27ClN4O/c1-4-14-18-5-6-20(14)10-7-19-8-11-21(12-9-19)15(22)16(2,3)13-17/h5-6H,4,7-13H2,1-3H3 |
| InChIKey | IELPJBNABUUZLC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|