C18H24ClN5O — CID 90561847
N-(4-chlorophenyl)-4-[2-(2-ethylimidazol-1-yl)ethyl]piperazine-1-carboxamide (PubChem CID 90561847) has the molecular formula C18H24ClN5O and a molecular weight of 361.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[2-(2-ethylimidazol-1-yl)ethyl]piperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-[2-(2-ethylimidazol-1-yl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 90561847 |
| Molecular Formula | C18H24ClN5O |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-(4-chlorophenyl)-4-[2-(2-ethylimidazol-1-yl)ethyl]piperazine-1-carboxamide |
| SMILES | CCc1nccn1CCN1CCN(C(=O)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H24ClN5O/c1-2-17-20-7-8-23(17)12-9-22-10-13-24(14-11-22)18(25)21-16-5-3-15(19)4-6-16/h3-8H,2,9-14H2,1H3,(H,21,25) |
| InChIKey | QDVNHTGMIXWFAS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |