C22H25FN2OS — CID 90567211
1-(2-benzyl-4-cyclopropylpiperazin-1-yl)-2-(4-fluorophenyl)sulfanylethanone (PubChem CID 90567211) has the molecular formula C22H25FN2OS and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-(2-benzyl-4-cyclopropylpiperazin-1-yl)-2-(4-fluorophenyl)sulfanylethanone.
| Compound Name | 1-(2-benzyl-4-cyclopropylpiperazin-1-yl)-2-(4-fluorophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 90567211 |
| Molecular Formula | C22H25FN2OS |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-(2-benzyl-4-cyclopropylpiperazin-1-yl)-2-(4-fluorophenyl)sulfanylethanone |
| SMILES | O=C(CSc1ccc(F)cc1)N1CCN(C2CC2)CC1Cc1ccccc1 |
| InChI | InChI=1S/C22H25FN2OS/c23-18-6-10-21(11-7-18)27-16-22(26)25-13-12-24(19-8-9-19)15-20(25)14-17-4-2-1-3-5-17/h1-7,10-11,19-20H,8-9,12-16H2 |
| InChIKey | PMXMXJBTKJWWAN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |