C25H32N2OS — CID 90567225
1-(2-benzyl-4-cyclopropylpiperazin-1-yl)-2-(4-propan-2-ylsulfanylphenyl)ethanone (PubChem CID 90567225) has the molecular formula C25H32N2OS and a molecular weight of 408.61 g/mol. Its IUPAC name is 1-(2-benzyl-4-cyclopropylpiperazin-1-yl)-2-(4-propan-2-ylsulfanylphenyl)ethanone.
| Compound Name | 1-(2-benzyl-4-cyclopropylpiperazin-1-yl)-2-(4-propan-2-ylsulfanylphenyl)ethanone |
|---|---|
| PubChem CID | 90567225 |
| Molecular Formula | C25H32N2OS |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1-(2-benzyl-4-cyclopropylpiperazin-1-yl)-2-(4-propan-2-ylsulfanylphenyl)ethanone |
| SMILES | CC(C)Sc1ccc(CC(=O)N2CCN(C3CC3)CC2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H32N2OS/c1-19(2)29-24-12-8-21(9-13-24)17-25(28)27-15-14-26(22-10-11-22)18-23(27)16-20-6-4-3-5-7-20/h3-9,12-13,19,22-23H,10-11,14-18H2,1-2H3 |
| InChIKey | DCFWSXFWFRHGAX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |