C17H23IN2OS — CID 90568446
(2-iodophenyl)-[3-(pyrrolidin-1-ylmethyl)-1,4-thiazepan-4-yl]methanone (PubChem CID 90568446) has the molecular formula C17H23IN2OS and a molecular weight of 430.36 g/mol. Its IUPAC name is (2-iodophenyl)-[3-(pyrrolidin-1-ylmethyl)-1,4-thiazepan-4-yl]methanone.
| Compound Name | (2-iodophenyl)-[3-(pyrrolidin-1-ylmethyl)-1,4-thiazepan-4-yl]methanone |
|---|---|
| PubChem CID | 90568446 |
| Molecular Formula | C17H23IN2OS |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | (2-iodophenyl)-[3-(pyrrolidin-1-ylmethyl)-1,4-thiazepan-4-yl]methanone |
| SMILES | O=C(c1ccccc1I)N1CCCSCC1CN1CCCC1 |
| InChI | InChI=1S/C17H23IN2OS/c18-16-7-2-1-6-15(16)17(21)20-10-5-11-22-13-14(20)12-19-8-3-4-9-19/h1-2,6-7,14H,3-5,8-13H2 |
| InChIKey | ZRPSJXHFJRZGFQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|