C17H23N3O4S — CID 90569198
[3-(morpholin-4-ylmethyl)-1,4-thiazepan-4-yl]-(2-nitrophenyl)methanone (PubChem CID 90569198) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is [3-(morpholin-4-ylmethyl)-1,4-thiazepan-4-yl]-(2-nitrophenyl)methanone.
| Compound Name | [3-(morpholin-4-ylmethyl)-1,4-thiazepan-4-yl]-(2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 90569198 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [3-(morpholin-4-ylmethyl)-1,4-thiazepan-4-yl]-(2-nitrophenyl)methanone |
| SMILES | O=C(c1ccccc1[N+](=O)[O-])N1CCCSCC1CN1CCOCC1 |
| InChI | InChI=1S/C17H23N3O4S/c21-17(15-4-1-2-5-16(15)20(22)23)19-6-3-11-25-13-14(19)12-18-7-9-24-10-8-18/h1-2,4-5,14H,3,6-13H2 |
| InChIKey | IGEVNSKCFQNQBU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|