C17H25N3O2S — CID 97105372
(3R)-3-(morpholin-4-ylmethyl)-N-phenyl-1,4-thiazepane-4-carboxamide (PubChem CID 97105372) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is (3R)-3-(morpholin-4-ylmethyl)-N-phenyl-1,4-thiazepane-4-carboxamide.
| Compound Name | (3R)-3-(morpholin-4-ylmethyl)-N-phenyl-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 97105372 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (3R)-3-(morpholin-4-ylmethyl)-N-phenyl-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCCSC[C@H]1CN1CCOCC1 |
| InChI | InChI=1S/C17H25N3O2S/c21-17(18-15-5-2-1-3-6-15)20-7-4-12-23-14-16(20)13-19-8-10-22-11-9-19/h1-3,5-6,16H,4,7-14H2,(H,18,21)/t16-/m1/s1 |
| InChIKey | RPYQRBIJFXBIMM-MRXNPFEDSA-N |
| XLogP | 2.36 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |