C14H18N4O — CID 90570703
1-ethyl-1-(imidazo[1,2-a]pyridin-3-ylmethyl)-3-prop-2-enylurea (PubChem CID 90570703) has the molecular formula C14H18N4O and a molecular weight of 258.33 g/mol. Its IUPAC name is 1-ethyl-1-(imidazo[1,2-a]pyridin-3-ylmethyl)-3-prop-2-enylurea.
| Compound Name | 1-ethyl-1-(imidazo[1,2-a]pyridin-3-ylmethyl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 90570703 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 1-ethyl-1-(imidazo[1,2-a]pyridin-3-ylmethyl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)N(CC)Cc1cnc2ccccn12 |
| InChI | InChI=1S/C14H18N4O/c1-3-8-15-14(19)17(4-2)11-12-10-16-13-7-5-6-9-18(12)13/h3,5-7,9-10H,1,4,8,11H2,2H3,(H,15,19) |
| InChIKey | SQLYERPWFZYUCW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|