C18H21N3O2S — CID 90570761
N,4-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 90570761) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N,4-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)benzenesulfonamide.
| Compound Name | N,4-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90570761 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N,4-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N(CC)Cc2cnc3ccccn23)cc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-3-15-8-10-17(11-9-15)24(22,23)20(4-2)14-16-13-19-18-7-5-6-12-21(16)18/h5-13H,3-4,14H2,1-2H3 |
| InChIKey | WLTLWRUIQOREQN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |