C15H15N5O2S — CID 90571218
1-[2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-5-methylpyrazol-3-yl]-3-prop-2-enylurea (PubChem CID 90571218) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is 1-[2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-5-methylpyrazol-3-yl]-3-prop-2-enylurea.
| Compound Name | 1-[2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-5-methylpyrazol-3-yl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 90571218 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1-[2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-5-methylpyrazol-3-yl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1cc(C)nn1-c1nc(-c2ccco2)cs1 |
| InChI | InChI=1S/C15H15N5O2S/c1-3-6-16-14(21)18-13-8-10(2)19-20(13)15-17-11(9-23-15)12-5-4-7-22-12/h3-5,7-9H,1,6H2,2H3,(H2,16,18,21) |
| InChIKey | IMBIUWKYVRTUFC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|