C18H19N5O5S2 — CID 90571252
2-(2,6-dioxopiperidin-1-yl)-N-[2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-5-methylpyrazol-3-yl]ethanesulfonamide (PubChem CID 90571252) has the molecular formula C18H19N5O5S2 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-1-yl)-N-[2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-5-methylpyrazol-3-yl]ethanesulfonamide.
| Compound Name | 2-(2,6-dioxopiperidin-1-yl)-N-[2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-5-methylpyrazol-3-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 90571252 |
| Molecular Formula | C18H19N5O5S2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 2-(2,6-dioxopiperidin-1-yl)-N-[2-[4-(furan-2-yl)-1,3-thiazol-2-yl]-5-methylpyrazol-3-yl]ethanesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)CCN2C(=O)CCCC2=O)n(-c2nc(-c3ccco3)cs2)n1 |
| InChI | InChI=1S/C18H19N5O5S2/c1-12-10-15(21-30(26,27)9-7-22-16(24)5-2-6-17(22)25)23(20-12)18-19-13(11-29-18)14-4-3-8-28-14/h3-4,8,10-11,21H,2,5-7,9H2,1H3 |
| InChIKey | DBNOMWQBNCBHPZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 127.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|