C15H12ClN5O3S — CID 90572124
5-chloro-2-nitro-N-[2-(2-pyrazol-1-yl-1,3-thiazol-4-yl)ethyl]benzamide (PubChem CID 90572124) has the molecular formula C15H12ClN5O3S and a molecular weight of 377.81 g/mol. Its IUPAC name is 5-chloro-2-nitro-N-[2-(2-pyrazol-1-yl-1,3-thiazol-4-yl)ethyl]benzamide.
| Compound Name | 5-chloro-2-nitro-N-[2-(2-pyrazol-1-yl-1,3-thiazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 90572124 |
| Molecular Formula | C15H12ClN5O3S |
| Molecular Weight | 377.81 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 5-chloro-2-nitro-N-[2-(2-pyrazol-1-yl-1,3-thiazol-4-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1csc(-n2cccn2)n1)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12ClN5O3S/c16-10-2-3-13(21(23)24)12(8-10)14(22)17-6-4-11-9-25-15(19-11)20-7-1-5-18-20/h1-3,5,7-9H,4,6H2,(H,17,22) |
| InChIKey | URQFCZYUZMAICN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.81 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|