C15H13Cl2N5OS — CID 90572226
1-(3,4-dichlorophenyl)-3-[2-(2-pyrazol-1-yl-1,3-thiazol-4-yl)ethyl]urea (PubChem CID 90572226) has the molecular formula C15H13Cl2N5OS and a molecular weight of 382.28 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[2-(2-pyrazol-1-yl-1,3-thiazol-4-yl)ethyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[2-(2-pyrazol-1-yl-1,3-thiazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 90572226 |
| Molecular Formula | C15H13Cl2N5OS |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[2-(2-pyrazol-1-yl-1,3-thiazol-4-yl)ethyl]urea |
| SMILES | O=C(NCCc1csc(-n2cccn2)n1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2N5OS/c16-12-3-2-10(8-13(12)17)20-14(23)18-6-4-11-9-24-15(21-11)22-7-1-5-19-22/h1-3,5,7-9H,4,6H2,(H2,18,20,23) |
| InChIKey | GLZCJRWTTOEXQG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |