C17H23NO3 — CID 90575523
N-[4-(2-methoxyphenoxy)but-2-ynyl]-3,3-dimethylbutanamide (PubChem CID 90575523) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[4-(2-methoxyphenoxy)but-2-ynyl]-3,3-dimethylbutanamide.
| Compound Name | N-[4-(2-methoxyphenoxy)but-2-ynyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 90575523 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[4-(2-methoxyphenoxy)but-2-ynyl]-3,3-dimethylbutanamide |
| SMILES | COc1ccccc1OCC#CCNC(=O)CC(C)(C)C |
| InChI | InChI=1S/C17H23NO3/c1-17(2,3)13-16(19)18-11-7-8-12-21-15-10-6-5-9-14(15)20-4/h5-6,9-10H,11-13H2,1-4H3,(H,18,19) |
| InChIKey | KOBKDQFVVJZDGH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|