C18H22N2O5 — CID 90577240
ethyl 4-[4-(3-acetamidophenoxy)but-2-ynylamino]-4-oxobutanoate (PubChem CID 90577240) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is ethyl 4-[4-(3-acetamidophenoxy)but-2-ynylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-(3-acetamidophenoxy)but-2-ynylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 90577240 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | ethyl 4-[4-(3-acetamidophenoxy)but-2-ynylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NCC#CCOc1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C18H22N2O5/c1-3-24-18(23)10-9-17(22)19-11-4-5-12-25-16-8-6-7-15(13-16)20-14(2)21/h6-8,13H,3,9-12H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | QPROAYJPPUAEPY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|