C20H22N2O5S — CID 90577516
N-[3-[4-[(2-methoxy-5-methylphenyl)sulfonylamino]but-2-ynoxy]phenyl]acetamide (PubChem CID 90577516) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[3-[4-[(2-methoxy-5-methylphenyl)sulfonylamino]but-2-ynoxy]phenyl]acetamide.
| Compound Name | N-[3-[4-[(2-methoxy-5-methylphenyl)sulfonylamino]but-2-ynoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 90577516 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[3-[4-[(2-methoxy-5-methylphenyl)sulfonylamino]but-2-ynoxy]phenyl]acetamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)NCC#CCOc1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C20H22N2O5S/c1-15-9-10-19(26-3)20(13-15)28(24,25)21-11-4-5-12-27-18-8-6-7-17(14-18)22-16(2)23/h6-10,13-14,21H,11-12H2,1-3H3,(H,22,23) |
| InChIKey | DJDZMUMFTRHFBK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|