C20H22N2O4S — CID 90577505
N-[3-[4-[(2,5-dimethylphenyl)sulfonylamino]but-2-ynoxy]phenyl]acetamide (PubChem CID 90577505) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is N-[3-[4-[(2,5-dimethylphenyl)sulfonylamino]but-2-ynoxy]phenyl]acetamide.
| Compound Name | N-[3-[4-[(2,5-dimethylphenyl)sulfonylamino]but-2-ynoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 90577505 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-[3-[4-[(2,5-dimethylphenyl)sulfonylamino]but-2-ynoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(OCC#CCNS(=O)(=O)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C20H22N2O4S/c1-15-9-10-16(2)20(13-15)27(24,25)21-11-4-5-12-26-19-8-6-7-18(14-19)22-17(3)23/h6-10,13-14,21H,11-12H2,1-3H3,(H,22,23) |
| InChIKey | KQGSXJRAQOAICQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|