C13H17ClN3O2+ — CID 9057785
(2-chlorophenyl)methyl-methyl-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium (PubChem CID 9057785) has the molecular formula C13H17ClN3O2+ and a molecular weight of 282.75 g/mol. Its IUPAC name is (2-chlorophenyl)methyl-methyl-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium.
| Compound Name | (2-chlorophenyl)methyl-methyl-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium |
|---|---|
| PubChem CID | 9057785 |
| Molecular Formula | C13H17ClN3O2+ |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (2-chlorophenyl)methyl-methyl-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium |
| SMILES | C[NH+](CC(=O)N1CCNC1=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C13H16ClN3O2/c1-16(8-10-4-2-3-5-11(10)14)9-12(18)17-7-6-15-13(17)19/h2-5H,6-9H2,1H3,(H,15,19)/p+1 |
| InChIKey | ZRXHQJILFXRDQA-UHFFFAOYSA-O |
| XLogP | -0.09 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |