C16H24N3O2+ — CID 9028478
methyl-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]-[(4-propan-2-ylphenyl)methyl]azanium (PubChem CID 9028478) has the molecular formula C16H24N3O2+ and a molecular weight of 290.39 g/mol. Its IUPAC name is methyl-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]-[(4-propan-2-ylphenyl)methyl]azanium.
| Compound Name | methyl-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]-[(4-propan-2-ylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9028478 |
| Molecular Formula | C16H24N3O2+ |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | methyl-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]-[(4-propan-2-ylphenyl)methyl]azanium |
| SMILES | CC(C)c1ccc(C[NH+](C)CC(=O)N2CCNC2=O)cc1 |
| InChI | InChI=1S/C16H23N3O2/c1-12(2)14-6-4-13(5-7-14)10-18(3)11-15(20)19-9-8-17-16(19)21/h4-7,12H,8-11H2,1-3H3,(H,17,21)/p+1 |
| InChIKey | WVCZGMLAZUWZOY-UHFFFAOYSA-O |
| XLogP | 0.38 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |