C14H19ClN3O2+ — CID 8541172
(4-chlorophenyl)methyl-methyl-[(2R)-1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl]azanium (PubChem CID 8541172) has the molecular formula C14H19ClN3O2+ and a molecular weight of 296.78 g/mol. Its IUPAC name is (4-chlorophenyl)methyl-methyl-[(2R)-1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl]azanium.
| Compound Name | (4-chlorophenyl)methyl-methyl-[(2R)-1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl]azanium |
|---|---|
| PubChem CID | 8541172 |
| Molecular Formula | C14H19ClN3O2+ |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (4-chlorophenyl)methyl-methyl-[(2R)-1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl]azanium |
| SMILES | C[C@H](C(=O)N1CCNC1=O)[NH+](C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClN3O2/c1-10(13(19)18-8-7-16-14(18)20)17(2)9-11-3-5-12(15)6-4-11/h3-6,10H,7-9H2,1-2H3,(H,16,20)/p+1/t10-/m1/s1 |
| InChIKey | PMYVQPSFZMSYMM-SNVBAGLBSA-O |
| XLogP | 0.29 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |