C14H18ClN3O2 — CID 8541173
1-[(2R)-2-[(4-chlorophenyl)methyl-methylamino]propanoyl]imidazolidin-2-one (PubChem CID 8541173) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 1-[(2R)-2-[(4-chlorophenyl)methyl-methylamino]propanoyl]imidazolidin-2-one.
| Compound Name | 1-[(2R)-2-[(4-chlorophenyl)methyl-methylamino]propanoyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 8541173 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-[(2R)-2-[(4-chlorophenyl)methyl-methylamino]propanoyl]imidazolidin-2-one |
| SMILES | C[C@H](C(=O)N1CCNC1=O)N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClN3O2/c1-10(13(19)18-8-7-16-14(18)20)17(2)9-11-3-5-12(15)6-4-11/h3-6,10H,7-9H2,1-2H3,(H,16,20)/t10-/m1/s1 |
| InChIKey | PMYVQPSFZMSYMM-SNVBAGLBSA-N |
| XLogP | 1.71 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |