C12H16BrN3O2S — CID 8971871
1-[(2R)-2-[(5-bromothiophen-2-yl)methyl-methylamino]propanoyl]imidazolidin-2-one (PubChem CID 8971871) has the molecular formula C12H16BrN3O2S and a molecular weight of 346.25 g/mol. Its IUPAC name is 1-[(2R)-2-[(5-bromothiophen-2-yl)methyl-methylamino]propanoyl]imidazolidin-2-one.
| Compound Name | 1-[(2R)-2-[(5-bromothiophen-2-yl)methyl-methylamino]propanoyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 8971871 |
| Molecular Formula | C12H16BrN3O2S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 1-[(2R)-2-[(5-bromothiophen-2-yl)methyl-methylamino]propanoyl]imidazolidin-2-one |
| SMILES | C[C@H](C(=O)N1CCNC1=O)N(C)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C12H16BrN3O2S/c1-8(11(17)16-6-5-14-12(16)18)15(2)7-9-3-4-10(13)19-9/h3-4,8H,5-7H2,1-2H3,(H,14,18)/t8-/m1/s1 |
| InChIKey | KIEWKIQZOYPKMT-MRVPVSSYSA-N |
| XLogP | 1.88 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |