C9H14BrNOS — CID 115736745
2-[(5-bromothiophen-2-yl)methyl-methylamino]propan-1-ol (PubChem CID 115736745) has the molecular formula C9H14BrNOS and a molecular weight of 264.19 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl-methylamino]propan-1-ol.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl-methylamino]propan-1-ol |
|---|---|
| PubChem CID | 115736745 |
| Molecular Formula | C9H14BrNOS |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl-methylamino]propan-1-ol |
| SMILES | CC(CO)N(C)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C9H14BrNOS/c1-7(6-12)11(2)5-8-3-4-9(10)13-8/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | OXJDFLQCUCDLTK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |