C13H11N3O3 — CID 90578764
N-(4-pyridin-3-yloxybut-2-ynyl)-1,2-oxazole-5-carboxamide (PubChem CID 90578764) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is N-(4-pyridin-3-yloxybut-2-ynyl)-1,2-oxazole-5-carboxamide.
| Compound Name | N-(4-pyridin-3-yloxybut-2-ynyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 90578764 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-(4-pyridin-3-yloxybut-2-ynyl)-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCC#CCOc1cccnc1)c1ccno1 |
| InChI | InChI=1S/C13H11N3O3/c17-13(12-5-8-16-19-12)15-7-1-2-9-18-11-4-3-6-14-10-11/h3-6,8,10H,7,9H2,(H,15,17) |
| InChIKey | RPTNXEFIGOGILZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|