C18H19N3O4 — CID 90579058
1-(3,4-dimethoxyphenyl)-3-(4-pyridin-3-yloxybut-2-ynyl)urea (PubChem CID 90579058) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(4-pyridin-3-yloxybut-2-ynyl)urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(4-pyridin-3-yloxybut-2-ynyl)urea |
|---|---|
| PubChem CID | 90579058 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(4-pyridin-3-yloxybut-2-ynyl)urea |
| SMILES | COc1ccc(NC(=O)NCC#CCOc2cccnc2)cc1OC |
| InChI | InChI=1S/C18H19N3O4/c1-23-16-8-7-14(12-17(16)24-2)21-18(22)20-10-3-4-11-25-15-6-5-9-19-13-15/h5-9,12-13H,10-11H2,1-2H3,(H2,20,21,22) |
| InChIKey | SPMDTRDPXGGQNE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|