C20H18N2O4 — CID 90579320
(E)-3-(1,3-benzodioxol-5-yl)-N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]prop-2-enamide (PubChem CID 90579320) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]prop-2-enamide |
|---|---|
| PubChem CID | 90579320 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]prop-2-enamide |
| SMILES | Cc1ccc(OCC#CCNC(=O)/C=C/c2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C20H18N2O4/c1-15-4-7-17(13-22-15)24-11-3-2-10-21-20(23)9-6-16-5-8-18-19(12-16)26-14-25-18/h4-9,12-13H,10-11,14H2,1H3,(H,21,23)/b9-6+ |
| InChIKey | OJXSPRSTPJWDJE-RMKNXTFCSA-N |
| XLogP | 2.33 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|