C20H24N2O4 — CID 90582229
N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-2-(3-methoxyphenoxy)acetamide (PubChem CID 90582229) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-2-(3-methoxyphenoxy)acetamide.
| Compound Name | N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-2-(3-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 90582229 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-2-(3-methoxyphenoxy)acetamide |
| SMILES | COc1cccc(OCC(=O)NCC(O)c2ccc3c(c2)CCN3C)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-22-9-8-14-10-15(6-7-18(14)22)19(23)12-21-20(24)13-26-17-5-3-4-16(11-17)25-2/h3-7,10-11,19,23H,8-9,12-13H2,1-2H3,(H,21,24) |
| InChIKey | NULRUNNYPBIWJR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|