C23H24N2O3 — CID 90582269
N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-2-naphthalen-2-yloxyacetamide (PubChem CID 90582269) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 90582269 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[2-hydroxy-2-(1-methyl-2,3-dihydroindol-5-yl)ethyl]-2-naphthalen-2-yloxyacetamide |
| SMILES | CN1CCc2cc(C(O)CNC(=O)COc3ccc4ccccc4c3)ccc21 |
| InChI | InChI=1S/C23H24N2O3/c1-25-11-10-18-12-19(7-9-21(18)25)22(26)14-24-23(27)15-28-20-8-6-16-4-2-3-5-17(16)13-20/h2-9,12-13,22,26H,10-11,14-15H2,1H3,(H,24,27) |
| InChIKey | UONYGBQMLFKFAY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|