C13H9ClN4O3 — CID 90585394
(4-chloro-3-nitrophenyl)-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)methanone (PubChem CID 90585394) has the molecular formula C13H9ClN4O3 and a molecular weight of 304.69 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)methanone |
|---|---|
| PubChem CID | 90585394 |
| Molecular Formula | C13H9ClN4O3 |
| Molecular Weight | 304.69 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)methanone |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N1Cc2cncnc2C1 |
| InChI | InChI=1S/C13H9ClN4O3/c14-10-2-1-8(3-12(10)18(20)21)13(19)17-5-9-4-15-7-16-11(9)6-17/h1-4,7H,5-6H2 |
| InChIKey | IGDDWKXDPWNBMW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.69 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|