C18H17ClFNO3S — CID 90585615
[2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(2-chloro-4-fluorophenyl)methanone (PubChem CID 90585615) has the molecular formula C18H17ClFNO3S and a molecular weight of 381.86 g/mol. Its IUPAC name is [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(2-chloro-4-fluorophenyl)methanone.
| Compound Name | [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(2-chloro-4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 90585615 |
| Molecular Formula | C18H17ClFNO3S |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | [2-(benzenesulfonylmethyl)pyrrolidin-1-yl]-(2-chloro-4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1Cl)N1CCCC1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17ClFNO3S/c19-17-11-13(20)8-9-16(17)18(22)21-10-4-5-14(21)12-25(23,24)15-6-2-1-3-7-15/h1-3,6-9,11,14H,4-5,10,12H2 |
| InChIKey | GXFRQLUCCYTMBT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |